data_bmse010163
#######################
# Entry information #
#######################
save_entry_information
_Entry.Sf_category entry_information
_Entry.Sf_framecode entry_information
_Entry.ID bmse010163
_Entry.Title lignin_cw_compound_246
_Entry.Version_type update
_Entry.Submission_date 2009-05-26
_Entry.Accession_date 2011-07-19
_Entry.Last_release_date 2013-04-05
_Entry.Original_release_date 2011-07-19
_Entry.Origination author
_Entry.NMR_STAR_version 3.1.1.31
_Entry.Original_NMR_STAR_version 3.1.0.46
_Entry.Experimental_method NMR
_Entry.Experimental_method_subtype solution
_Entry.DOI 10.13018/BMSE010163
_Entry.Details ?
_Entry.BMRB_internal_directory_name lignin_cw_compound_246
loop_
_Entry_author.Ordinal
_Entry_author.Given_name
_Entry_author.Family_name
_Entry_author.Middle_initials
_Entry_author.Family_title
_Entry_author.Entry_ID
1 Sally Ralph ? ? bmse010163
2 John Ralph ? ? bmse010163
stop_
loop_
_Entry_src.ID
_Entry_src.Project_name
_Entry_src.Organization_full_name
_Entry_src.Organization_initials
_Entry_src.Entry_ID
1 'NMR Database of Lignin and Cell Wall Model Compounds' 'United States Department of Agriculture' USDA bmse010163
stop_
loop_
_Data_set.Type
_Data_set.Count
_Data_set.Entry_ID
assigned_chemical_shifts 3 bmse010163
stop_
loop_
_Datum.Type
_Datum.Count
_Datum.Entry_ID
'13C chemical shifts' 72 bmse010163
'1H chemical shifts' 22 bmse010163
stop_
loop_
_Release.Release_number
_Release.Format_type
_Release.Format_version
_Release.Date
_Release.Submission_date
_Release.Type
_Release.Author
_Release.Detail
_Release.Entry_ID
1 . . 2011-07-19 2009-05-26 original Author 'Original spectra from USDA' bmse010163
2 . . 2011-09-07 2009-05-26 update BMRB 'Ensured correct reference IDs' bmse010163
3 . . 2011-09-09 2009-05-26 update BMRB 'Brought up to date with latest Dictionary' bmse010163
4 . . 2011-12-14 2009-05-26 update BMRB 'Set Assembly.Name to match Chem_comp.name' bmse010163
5 . . 2011-12-16 2009-05-26 update BMRB 'Standardized solvent' bmse010163
6 . . 2012-02-24 2009-05-26 update BMRB 'Set Raw_data_flag to no, since there are no raw data' bmse010163
7 . . 2013-04-05 2009-05-26 update BMRB 'Adding molecule category to chem_comp Details' bmse010163
8 . . 2017-10-12 2017-10-12 update BMRB 'Remediated Experiment_file loop if present and standardized mol and png file tags.' bmse010163
9 . . 2018-07-10 2017-10-12 update BMRB 'InChI numbering updated according to ALATIS' bmse010163
stop_
save_
###############
# Citations #
###############
save_citation_1
_Citation.Sf_category citations
_Citation.Sf_framecode citation_1
_Citation.Entry_ID bmse010163
_Citation.ID 1
_Citation.Class 'entry citation'
_Citation.PubMed_ID ?
_Citation.Title 'NMR Database of Lignin and Cell Wall Model Compounds.'
_Citation.Status published
_Citation.Type Internet
_Citation.WWW_URL http://ars.usda.gov/Services/docs.htm?docid=10491
_Citation.Year 2004
_Citation.Details ?
loop_
_Citation_author.Ordinal
_Citation_author.Given_name
_Citation_author.Family_name
_Citation_author.First_initial
_Citation_author.Middle_initials
_Citation_author.Family_title
_Citation_author.Entry_ID
_Citation_author.Citation_ID
1 Sally Ralph ? A. ? bmse010163 1
2 John Ralph ? ? ? bmse010163 1
3 Larry Landucci ? L. ? bmse010163 1
stop_
save_
#############################################
# Molecular system (assembly) description #
#############################################
save_assembly
_Assembly.Sf_category assembly
_Assembly.Sf_framecode assembly
_Assembly.Entry_ID bmse010163
_Assembly.ID 1
_Assembly.Name lignin_cw_compound_246
_Assembly.Number_of_components 1
_Assembly.Organic_ligands 0
_Assembly.Metal_ions ?
_Assembly.Non_standard_bonds no
_Assembly.Paramagnetic no
_Assembly.Thiol_state 'not reported'
loop_
_Entity_assembly.ID
_Entity_assembly.Entity_assembly_name
_Entity_assembly.Entity_ID
_Entity_assembly.Entity_label
_Entity_assembly.Experimental_data_reported
_Entity_assembly.Physical_state
_Entity_assembly.Conformational_isomer
_Entity_assembly.Chemical_exchange_state
_Entity_assembly.Magnetic_equivalence_group_code
_Entity_assembly.Role
_Entity_assembly.Details
_Entity_assembly.Entry_ID
_Entity_assembly.Assembly_ID
1 $lignin_cw_compound_246 1 $lignin_cw_compound_246 yes native no no ? ? ? bmse010163 1
stop_
save_
####################################
# Biological polymers and ligands #
####################################
save_lignin_cw_compound_246
_Entity.Sf_category entity
_Entity.Sf_framecode lignin_cw_compound_246
_Entity.Entry_ID bmse010163
_Entity.ID 1
_Entity.BMRB_code ?
_Entity.Name lignin_cw_compound_246
_Entity.Type non-polymer
_Entity.Ambiguous_conformational_states no
_Entity.Ambiguous_chem_comp_sites no
_Entity.Nstd_monomer no
_Entity.Nstd_chirality no
_Entity.Nstd_linkage no
_Entity.Paramagnetic no
_Entity.Thiol_state 'not reported'
loop_
_Entity_comp_index.ID
_Entity_comp_index.Comp_ID
_Entity_comp_index.Comp_label
_Entity_comp_index.Entry_ID
_Entity_comp_index.Entity_ID
1 1 $chem_comp_1 bmse010163 1
stop_
save_
####################
# Natural source #
####################
save_natural_source
_Entity_natural_src_list.Sf_category natural_source
_Entity_natural_src_list.Sf_framecode natural_source
_Entity_natural_src_list.Entry_ID bmse010163
_Entity_natural_src_list.ID 1
loop_
_Entity_natural_src.ID
_Entity_natural_src.Entity_ID
_Entity_natural_src.Entity_label
_Entity_natural_src.Entity_chimera_segment_ID
_Entity_natural_src.NCBI_taxonomy_ID
_Entity_natural_src.Type
_Entity_natural_src.Common
_Entity_natural_src.Organism_name_scientific
_Entity_natural_src.Organism_name_common
_Entity_natural_src.Organism_acronym
_Entity_natural_src.ICTVdb_decimal_code
_Entity_natural_src.Superkingdom
_Entity_natural_src.Kingdom
_Entity_natural_src.Genus
_Entity_natural_src.Species
_Entity_natural_src.Strain
_Entity_natural_src.Variant
_Entity_natural_src.Subvariant
_Entity_natural_src.Organ
_Entity_natural_src.Tissue
_Entity_natural_src.Tissue_fraction
_Entity_natural_src.Cell_line
_Entity_natural_src.Cell_type
_Entity_natural_src.ATCC_number
_Entity_natural_src.Organelle
_Entity_natural_src.Cellular_location
_Entity_natural_src.Fragment
_Entity_natural_src.Fraction
_Entity_natural_src.Secretion
_Entity_natural_src.Plasmid
_Entity_natural_src.Plasmid_details
_Entity_natural_src.Gene_mnemonic
_Entity_natural_src.Dev_stage
_Entity_natural_src.Details
_Entity_natural_src.Citation_ID
_Entity_natural_src.Citation_label
_Entity_natural_src.Entry_ID
_Entity_natural_src.Entity_natural_src_list_ID
1 1 $lignin_cw_compound_246 . n/a 'multiple natural sources' yes 'not applicable' n/a . . Eukaryota Viridiplantae n/a n/a . . . . . . . . . . . . . . . . . . . . . bmse010163 1
stop_
save_
#########################
# Experimental source #
#########################
save_experimental_source
_Entity_experimental_src_list.Sf_category experimental_source
_Entity_experimental_src_list.Sf_framecode experimental_source
_Entity_experimental_src_list.Entry_ID bmse010163
_Entity_experimental_src_list.ID 1
loop_
_Entity_experimental_src.ID
_Entity_experimental_src.Entity_ID
_Entity_experimental_src.Entity_label
_Entity_experimental_src.Entity_chimera_segment_ID
_Entity_experimental_src.Production_method
_Entity_experimental_src.Host_org_scientific_name
_Entity_experimental_src.Host_org_name_common
_Entity_experimental_src.Host_org_details
_Entity_experimental_src.Host_org_NCBI_taxonomy_ID
_Entity_experimental_src.Host_org_genus
_Entity_experimental_src.Host_org_species
_Entity_experimental_src.Host_org_strain
_Entity_experimental_src.Host_org_variant
_Entity_experimental_src.Host_org_subvariant
_Entity_experimental_src.Host_org_organ
_Entity_experimental_src.Host_org_tissue
_Entity_experimental_src.Host_org_tissue_fraction
_Entity_experimental_src.Host_org_cell_line
_Entity_experimental_src.Host_org_cell_type
_Entity_experimental_src.Host_org_cellular_location
_Entity_experimental_src.Host_org_organelle
_Entity_experimental_src.Host_org_gene
_Entity_experimental_src.Host_org_culture_collection
_Entity_experimental_src.Host_org_ATCC_number
_Entity_experimental_src.Vector_type
_Entity_experimental_src.PDBview_host_org_vector_name
_Entity_experimental_src.PDBview_plasmid_name
_Entity_experimental_src.Vector_name
_Entity_experimental_src.Vector_details
_Entity_experimental_src.Vendor_name
_Entity_experimental_src.Host_org_dev_stage
_Entity_experimental_src.Details
_Entity_experimental_src.Citation_ID
_Entity_experimental_src.Citation_label
_Entity_experimental_src.Entry_ID
_Entity_experimental_src.Entity_experimental_src_list_ID
1 1 $lignin_cw_compound_246 . 'chemical synthesis' . . . . . . . . . . . . . . . . . . . . . . . . . . . . . bmse010163 1
stop_
save_
#################################
# Polymer residues and ligands #
#################################
save_chem_comp_1
_Chem_comp.Sf_category chem_comp
_Chem_comp.Sf_framecode chem_comp_1
_Chem_comp.Entry_ID bmse010163
_Chem_comp.ID 1
_Chem_comp.Provenance BMRB
_Chem_comp.Name lignin_cw_compound_246
_Chem_comp.Type non-polymer
_Chem_comp.BMRB_code ?
_Chem_comp.PDB_code ?
_Chem_comp.InChI_code InChI=1S/C24H28O10/c1-13-8-17(28-4)24(18(9-13)29-5)34-21(12-32-14(2)25)22(27)16-10-19(30-6)23(33-15(3)26)20(11-16)31-7/h8-11,21H,12H2,1-7H3/t21-/m1/s1
_Chem_comp.Mon_nstd_flag ?
_Chem_comp.Std_deriv_one_letter_code ?
_Chem_comp.Std_deriv_three_letter_code ?
_Chem_comp.Std_deriv_BMRB_code ?
_Chem_comp.Std_deriv_PDB_code ?
_Chem_comp.Formal_charge ?
_Chem_comp.Paramagnetic no
_Chem_comp.Aromatic yes
_Chem_comp.Formula 'C24 H28 O10'
_Chem_comp.Formula_weight 476.47312
_Chem_comp.Formula_mono_iso_wt_nat 476.1682471198
_Chem_comp.Formula_mono_iso_wt_13C 500.248763227
_Chem_comp.Formula_mono_iso_wt_15N 476.1682471198
_Chem_comp.Formula_mono_iso_wt_13C_15N 500.248763227
_Chem_comp.Image_file_name bmse010163.png
_Chem_comp.Image_file_format png
_Chem_comp.Topo_file_name ?
_Chem_comp.Topo_file_format ?
_Chem_comp.Struct_file_name bmse010163.mol
_Chem_comp.Struct_file_format mol
_Chem_comp.Stereochem_param_file_name ?
_Chem_comp.Details 'b-O-4 Dimers, 3-Carbon Sidechain, a-C=O'
_Chem_comp.DB_query_date ?
_Chem_comp.DB_last_query_revised_last_date ?
loop_
_Chem_comp_common_name.Name
_Chem_comp_common_name.Type
_Chem_comp_common_name.Entry_ID
_Chem_comp_common_name.Comp_ID
Unnamed synonym bmse010163 1
stop_
loop_
_Chem_comp_descriptor.Descriptor
_Chem_comp_descriptor.Type
_Chem_comp_descriptor.Program
_Chem_comp_descriptor.Program_version
_Chem_comp_descriptor.Entry_ID
_Chem_comp_descriptor.Comp_ID
;
InChI=1/C24H28O10/c1-13-8-17(28-4)24(18(9-13)29-5)34-21(12-32-14(2)25)22(27)16-10-19(30-6)23(33-15(3)26)20(11-16)31-7/h8-11,21H,12H2,1-7H3
;
INCHI na na bmse010163 1
InChI=1S/C24H28O10/c1-13-8-17(28-4)24(18(9-13)29-5)34-21(12-32-14(2)25)22(27)16-10-19(30-6)23(33-15(3)26)20(11-16)31-7/h8-11,21H,12H2,1-7H3/t21-/m1/s1 INCHI ALATIS 3.003 bmse010163 1
stop_
loop_
_Chem_comp_systematic_name.Name
_Chem_comp_systematic_name.Naming_system
_Chem_comp_systematic_name.Entry_ID
_Chem_comp_systematic_name.Comp_ID
'To be defined' Beilstein bmse010163 1
stop_
loop_
_Chem_comp_SMILES.Type
_Chem_comp_SMILES.String
_Chem_comp_SMILES.Entry_ID
_Chem_comp_SMILES.Comp_ID
Canonical CC1=CC(=C(C(=C1)OC)OC(COC(C)=O)C(C2=CC(=C(C(=C2)OC)OC(C)=O)OC)=O)OC bmse010163 1
Isomeric CC1=CC(=C(C(=C1)OC)OC(COC(C)=O)C(C2=CC(=C(C(=C2)OC)OC(C)=O)OC)=O)OC bmse010163 1
stop_
loop_
_Chem_comp_atom.Atom_ID
_Chem_comp_atom.Auth_atom_ID
_Chem_comp_atom.Type_symbol
_Chem_comp_atom.Stereo_config
_Chem_comp_atom.Charge
_Chem_comp_atom.Oxidation_number
_Chem_comp_atom.Unpaired_electron_number
_Chem_comp_atom.Drawing_2D_coord_x
_Chem_comp_atom.Drawing_2D_coord_y
_Chem_comp_atom.Model_Cartn_x
_Chem_comp_atom.Model_Cartn_y
_Chem_comp_atom.Model_Cartn_z
_Chem_comp_atom.PDBX_ordinal
_Chem_comp_atom.Entry_ID
_Chem_comp_atom.Comp_ID
C1 BA C ? ? ? ? 318.7792 17.8592 ? ? ? 1 bmse010163 1
C2 GAcMe C ? ? ? ? 164.1488 170.1408 ? ? ? 2 bmse010163 1
C3 A4AcMe C ? ? ? ? 330.4272 362.1408 ? ? ? 3 bmse010163 1
C4 BOMe C ? ? ? ? 369.5408 121.4688 ? ? ? 4 bmse010163 1
C5 BOMe C ? ? ? ? 213.2944 64.5984 ? ? ? 5 bmse010163 1
C6 AOMe C ? ? ? ? 219.5760 266.1408 ? ? ? 6 bmse010163 1
C7 AOMe C ? ? ? ? 385.8512 266.1408 ? ? ? 7 bmse010163 1
C8 B2 C ? ? ? ? 328.4016 72.4448 ? ? ? 8 bmse010163 1
C9 B6 C ? ? ? ? 276.3216 53.4880 ? ? ? 9 bmse010163 1
C10 A2 C ? ? ? ? 275.0000 234.1408 ? ? ? 10 bmse010163 1
C11 A6 C ? ? ? ? 330.4272 234.1408 ? ? ? 11 bmse010163 1
C12 G C ? ? ? ? 247.2880 186.1408 ? ? ? 12 bmse010163 1
C13 B1 C ? ? ? ? 307.8352 47.9296 ? ? ? 13 bmse010163 1
C14 GAcC=O C ? ? ? ? 191.8608 186.1408 ? ? ? 14 bmse010163 1
C15 A4AcC=O C ? ? ? ? 330.4272 330.1408 ? ? ? 15 bmse010163 1
C16 A1 C ? ? ? ? 302.7120 218.1408 ? ? ? 16 bmse010163 1
C17 B3 C ? ? ? ? 317.4576 102.5120 ? ? ? 17 bmse010163 1
C18 B5 C ? ? ? ? 265.3744 83.5552 ? ? ? 18 bmse010163 1
C19 A3 C ? ? ? ? 275.0000 266.1408 ? ? ? 19 bmse010163 1
C20 A5 C ? ? ? ? 330.4272 266.1408 ? ? ? 20 bmse010163 1
C21 B C ? ? ? ? 275.0000 170.1408 ? ? ? 21 bmse010163 1
C22 A C ? ? ? ? 302.7120 186.1408 ? ? ? 22 bmse010163 1
C23 A4 C ? ? ? ? 302.7120 282.1408 ? ? ? 23 bmse010163 1
C24 B4 C ? ? ? ? 285.9440 108.0704 ? ? ? 24 bmse010163 1
O25 ? O ? ? ? ? 191.8608 218.1408 ? ? ? 25 bmse010163 1
O26 ? O ? ? ? ? 358.1392 314.1408 ? ? ? 26 bmse010163 1
O27 ? O ? ? ? ? 330.4272 170.1408 ? ? ? 27 bmse010163 1
O28 ? O ? ? ? ? 338.0272 127.0272 ? ? ? 28 bmse010163 1
O29 ? O ? ? ? ? 233.8640 89.1104 ? ? ? 29 bmse010163 1
O30 ? O ? ? ? ? 247.2880 282.1408 ? ? ? 30 bmse010163 1
O31 ? O ? ? ? ? 358.1392 282.1408 ? ? ? 31 bmse010163 1
O32 ? O ? ? ? ? 219.5760 170.1408 ? ? ? 32 bmse010163 1
O33 ? O ? ? ? ? 302.7120 314.1408 ? ? ? 33 bmse010163 1
O34 ? O ? ? ? ? 275.0000 138.1408 ? ? ? 34 bmse010163 1
H36 BA H ? ? ? ? 300.1356 11.0739 ? ? ? 35 bmse010163 1
H35 BA H ? ? ? ? 325.5645 -0.7844 ? ? ? 36 bmse010163 1
H37 BA H ? ? ? ? 337.4229 24.6445 ? ? ? 37 bmse010163 1
H38 GAcMe H ? ? ? ? 154.2286 187.3226 ? ? ? 38 bmse010163 1
H39 GAcMe H ? ? ? ? 146.9670 160.2206 ? ? ? 39 bmse010163 1
H40 GAcMe H ? ? ? ? 174.0690 152.9590 ? ? ? 40 bmse010163 1
H43 A4AcMe H ? ? ? ? 350.2672 362.1408 ? ? ? 41 bmse010163 1
H42 A4AcMe H ? ? ? ? 330.4272 381.9808 ? ? ? 42 bmse010163 1
H41 A4AcMe H ? ? ? ? 310.5872 362.1408 ? ? ? 43 bmse010163 1
H44 ? H ? ? ? ? 366.0946 101.9304 ? ? ? 44 bmse010163 1
H46 BOMe H ? ? ? ? 389.0792 118.0226 ? ? ? 45 bmse010163 1
H45 BOMe H ? ? ? ? 372.9870 141.0072 ? ? ? 46 bmse010163 1
H48 BOMe H ? ? ? ? 198.0966 77.3519 ? ? ? 47 bmse010163 1
H47 AOMe H ? ? ? ? 200.5409 49.4006 ? ? ? 48 bmse010163 1
H49 AOMe H ? ? ? ? 228.4922 51.8449 ? ? ? 49 bmse010163 1
H50 AOMe H ? ? ? ? 209.6558 283.3226 ? ? ? 50 bmse010163 1
H51 ? H ? ? ? ? 202.3942 256.2206 ? ? ? 51 bmse010163 1
H52 ? H ? ? ? ? 229.4962 248.9590 ? ? ? 52 bmse010163 1
H54 ? H ? ? ? ? 375.9310 248.9590 ? ? ? 53 bmse010163 1
H55 ? H ? ? ? ? 403.0330 256.2206 ? ? ? 54 bmse010163 1
H53 ? H ? ? ? ? 395.7714 283.3226 ? ? ? 55 bmse010163 1
H56 B2 H ? ? ? ? 347.9404 69.0007 ? ? ? 56 bmse010163 1
H57 B6 H ? ? ? ? 263.5691 38.2893 ? ? ? 57 bmse010163 1
H58 A2 H ? ? ? ? 257.8180 224.2209 ? ? ? 58 bmse010163 1
H59 A6 H ? ? ? ? 347.6089 224.2205 ? ? ? 59 bmse010163 1
H60 G H ? ? ? ? 260.0410 201.3391 ? ? ? 60 bmse010163 1
H61 G H ? ? ? ? 234.5350 201.3391 ? ? ? 61 bmse010163 1
H62 B H ? ? ? ? 292.1820 160.2209 ? ? ? 62 bmse010163 1
stop_
loop_
_Atom_nomenclature.Atom_ID
_Atom_nomenclature.Atom_name
_Atom_nomenclature.Naming_system
_Atom_nomenclature.Entry_ID
_Atom_nomenclature.Comp_ID
C1 C1 BMRB bmse010163 1
C2 C2 BMRB bmse010163 1
C3 C3 BMRB bmse010163 1
C4 C4 BMRB bmse010163 1
C5 C5 BMRB bmse010163 1
C6 C6 BMRB bmse010163 1
C7 C7 BMRB bmse010163 1
C8 C8 BMRB bmse010163 1
C9 C9 BMRB bmse010163 1
C10 C10 BMRB bmse010163 1
C11 C11 BMRB bmse010163 1
C12 C12 BMRB bmse010163 1
C13 C13 BMRB bmse010163 1
C14 C14 BMRB bmse010163 1
C15 C15 BMRB bmse010163 1
C16 C16 BMRB bmse010163 1
C17 C17 BMRB bmse010163 1
C18 C18 BMRB bmse010163 1
C19 C19 BMRB bmse010163 1
C20 C20 BMRB bmse010163 1
C21 C21 BMRB bmse010163 1
C22 C22 BMRB bmse010163 1
C23 C23 BMRB bmse010163 1
C24 C24 BMRB bmse010163 1
O25 O25 BMRB bmse010163 1
O26 O26 BMRB bmse010163 1
O27 O27 BMRB bmse010163 1
O28 O28 BMRB bmse010163 1
O29 O29 BMRB bmse010163 1
O30 O30 BMRB bmse010163 1
O31 O31 BMRB bmse010163 1
O32 O32 BMRB bmse010163 1
O33 O33 BMRB bmse010163 1
O34 O34 BMRB bmse010163 1
H36 H35 BMRB bmse010163 1
H35 H36 BMRB bmse010163 1
H37 H37 BMRB bmse010163 1
H38 H38 BMRB bmse010163 1
H39 H39 BMRB bmse010163 1
H40 H40 BMRB bmse010163 1
H43 H41 BMRB bmse010163 1
H42 H42 BMRB bmse010163 1
H41 H43 BMRB bmse010163 1
H44 H44 BMRB bmse010163 1
H46 H45 BMRB bmse010163 1
H45 H46 BMRB bmse010163 1
H48 H47 BMRB bmse010163 1
H47 H48 BMRB bmse010163 1
H49 H49 BMRB bmse010163 1
H50 H50 BMRB bmse010163 1
H51 H51 BMRB bmse010163 1
H52 H52 BMRB bmse010163 1
H54 H53 BMRB bmse010163 1
H55 H54 BMRB bmse010163 1
H53 H55 BMRB bmse010163 1
H56 H56 BMRB bmse010163 1
H57 H57 BMRB bmse010163 1
H58 H58 BMRB bmse010163 1
H59 H59 BMRB bmse010163 1
H60 H60 BMRB bmse010163 1
H61 H61 BMRB bmse010163 1
H62 H62 BMRB bmse010163 1
C1 C1 ALATIS bmse010163 1
C2 C2 ALATIS bmse010163 1
C3 C3 ALATIS bmse010163 1
C4 C4 ALATIS bmse010163 1
C5 C5 ALATIS bmse010163 1
C6 C6 ALATIS bmse010163 1
C7 C7 ALATIS bmse010163 1
C8 C8 ALATIS bmse010163 1
C9 C9 ALATIS bmse010163 1
C10 C10 ALATIS bmse010163 1
C11 C11 ALATIS bmse010163 1
C12 C12 ALATIS bmse010163 1
C13 C13 ALATIS bmse010163 1
C14 C14 ALATIS bmse010163 1
C15 C15 ALATIS bmse010163 1
C16 C16 ALATIS bmse010163 1
C17 C17 ALATIS bmse010163 1
C18 C18 ALATIS bmse010163 1
C19 C19 ALATIS bmse010163 1
C20 C20 ALATIS bmse010163 1
C21 C21 ALATIS bmse010163 1
C22 C22 ALATIS bmse010163 1
C23 C23 ALATIS bmse010163 1
C24 C24 ALATIS bmse010163 1
O25 O25 ALATIS bmse010163 1
O26 O26 ALATIS bmse010163 1
O27 O27 ALATIS bmse010163 1
O28 O28 ALATIS bmse010163 1
O29 O29 ALATIS bmse010163 1
O30 O30 ALATIS bmse010163 1
O31 O31 ALATIS bmse010163 1
O32 O32 ALATIS bmse010163 1
O33 O33 ALATIS bmse010163 1
O34 O34 ALATIS bmse010163 1
H36 H36 ALATIS bmse010163 1
H35 H35 ALATIS bmse010163 1
H37 H37 ALATIS bmse010163 1
H38 H38 ALATIS bmse010163 1
H39 H39 ALATIS bmse010163 1
H40 H40 ALATIS bmse010163 1
H43 H43 ALATIS bmse010163 1
H42 H42 ALATIS bmse010163 1
H41 H41 ALATIS bmse010163 1
H44 H44 ALATIS bmse010163 1
H46 H46 ALATIS bmse010163 1
H45 H45 ALATIS bmse010163 1
H48 H48 ALATIS bmse010163 1
H47 H47 ALATIS bmse010163 1
H49 H49 ALATIS bmse010163 1
H50 H50 ALATIS bmse010163 1
H51 H51 ALATIS bmse010163 1
H52 H52 ALATIS bmse010163 1
H54 H54 ALATIS bmse010163 1
H55 H55 ALATIS bmse010163 1
H53 H53 ALATIS bmse010163 1
H56 H56 ALATIS bmse010163 1
H57 H57 ALATIS bmse010163 1
H58 H58 ALATIS bmse010163 1
H59 H59 ALATIS bmse010163 1
H60 H60 ALATIS bmse010163 1
H61 H61 ALATIS bmse010163 1
H62 H62 ALATIS bmse010163 1
stop_
loop_
_Chem_comp_bond.ID
_Chem_comp_bond.Type
_Chem_comp_bond.Value_order
_Chem_comp_bond.Atom_ID_1
_Chem_comp_bond.Atom_ID_2
_Chem_comp_bond.Details
_Chem_comp_bond.Entry_ID
_Chem_comp_bond.Comp_ID
1 covalent SING C1 C13 ? bmse010163 1
2 covalent SING C2 C14 ? bmse010163 1
3 covalent SING C3 C15 ? bmse010163 1
4 covalent SING C4 O28 ? bmse010163 1
5 covalent SING C5 O29 ? bmse010163 1
6 covalent SING C6 O30 ? bmse010163 1
7 covalent SING C7 O31 ? bmse010163 1
8 covalent DOUB C8 C13 ? bmse010163 1
9 covalent SING C8 C17 ? bmse010163 1
10 covalent SING C9 C13 ? bmse010163 1
11 covalent DOUB C9 C18 ? bmse010163 1
12 covalent DOUB C10 C16 ? bmse010163 1
13 covalent SING C10 C19 ? bmse010163 1
14 covalent SING C11 C16 ? bmse010163 1
15 covalent DOUB C11 C20 ? bmse010163 1
16 covalent SING C12 C21 ? bmse010163 1
17 covalent SING C12 O32 ? bmse010163 1
18 covalent DOUB C14 O25 ? bmse010163 1
19 covalent SING C14 O32 ? bmse010163 1
20 covalent DOUB C15 O26 ? bmse010163 1
21 covalent SING C15 O33 ? bmse010163 1
22 covalent SING C16 C22 ? bmse010163 1
23 covalent DOUB C17 C24 ? bmse010163 1
24 covalent SING C17 O28 ? bmse010163 1
25 covalent SING C18 C24 ? bmse010163 1
26 covalent SING C18 O29 ? bmse010163 1
27 covalent DOUB C19 C23 ? bmse010163 1
28 covalent SING C19 O30 ? bmse010163 1
29 covalent SING C20 C23 ? bmse010163 1
30 covalent SING C20 O31 ? bmse010163 1
31 covalent SING C21 C22 ? bmse010163 1
32 covalent SING C21 O34 ? bmse010163 1
33 covalent DOUB C22 O27 ? bmse010163 1
34 covalent SING C23 O33 ? bmse010163 1
35 covalent SING C24 O34 ? bmse010163 1
36 covalent SING C1 H36 ? bmse010163 1
37 covalent SING C1 H35 ? bmse010163 1
38 covalent SING C1 H37 ? bmse010163 1
39 covalent SING C2 H38 ? bmse010163 1
40 covalent SING C2 H39 ? bmse010163 1
41 covalent SING C2 H40 ? bmse010163 1
42 covalent SING C3 H43 ? bmse010163 1
43 covalent SING C3 H42 ? bmse010163 1
44 covalent SING C3 H41 ? bmse010163 1
45 covalent SING C4 H44 ? bmse010163 1
46 covalent SING C4 H46 ? bmse010163 1
47 covalent SING C4 H45 ? bmse010163 1
48 covalent SING C5 H48 ? bmse010163 1
49 covalent SING C5 H47 ? bmse010163 1
50 covalent SING C5 H49 ? bmse010163 1
51 covalent SING C6 H50 ? bmse010163 1
52 covalent SING C6 H51 ? bmse010163 1
53 covalent SING C6 H52 ? bmse010163 1
54 covalent SING C7 H54 ? bmse010163 1
55 covalent SING C7 H55 ? bmse010163 1
56 covalent SING C7 H53 ? bmse010163 1
57 covalent SING C8 H56 ? bmse010163 1
58 covalent SING C9 H57 ? bmse010163 1
59 covalent SING C10 H58 ? bmse010163 1
60 covalent SING C11 H59 ? bmse010163 1
61 covalent SING C12 H60 ? bmse010163 1
62 covalent SING C12 H61 ? bmse010163 1
63 covalent SING C21 H62 ? bmse010163 1
stop_
loop_
_Chem_comp_db_link.Author_supplied
_Chem_comp_db_link.Database_code
_Chem_comp_db_link.Accession_code
_Chem_comp_db_link.Accession_code_type
_Chem_comp_db_link.Entry_mol_code
_Chem_comp_db_link.Entry_mol_name
_Chem_comp_db_link.Entry_experimental_method
_Chem_comp_db_link.Entry_relation_type
_Chem_comp_db_link.Entry_details
_Chem_comp_db_link.Entry_ID
_Chem_comp_db_link.Comp_ID
yes USDA_NMR_database 246 'Compound Number' ? lignin_cw_compound_246 ? 'matching entry' ? bmse010163 1
stop_
loop_
_Chem_comp_citation.Citation_ID
_Chem_comp_citation.Citation_label
_Chem_comp_citation.Entry_ID
_Chem_comp_citation.Comp_ID
1 $citation_1 bmse010163 1
stop_
save_
#####################################
# Sample contents and methodology #
#####################################
########################
# Sample description #
########################
save_sample_1
_Sample.Sf_category sample
_Sample.Sf_framecode sample_1
_Sample.Entry_ID bmse010163
_Sample.ID 1
_Sample.Type solution
loop_
_Sample_component.ID
_Sample_component.Mol_common_name
_Sample_component.Isotopic_labeling
_Sample_component.Entity_ID
_Sample_component.Entity_label
_Sample_component.Product_ID
_Sample_component.Type
_Sample_component.Concentration_val
_Sample_component.Concentration_val_min
_Sample_component.Concentration_val_max
_Sample_component.Concentration_val_units
_Sample_component.Concentration_val_err
_Sample_component.Vendor
_Sample_component.Vendor_product_name
_Sample_component.Vendor_product_code
_Sample_component.Entry_ID
_Sample_component.Sample_ID
1 lignin_cw_compound_246 'natural abundance' 1 $lignin_cw_compound_246 ? Solute Saturated ? ? 1 ? 'Sally Ralph' lignin_cw_compound_246 n/a bmse010163 1
2 CDCl3 ? 1 ? ? Solvent 100 ? ? % ? ? ? ? bmse010163 1
stop_
save_
#####################################
# Sample contents and methodology #
#####################################
########################
# Sample description #
########################
save_sample_2
_Sample.Sf_category sample
_Sample.Sf_framecode sample_2
_Sample.Entry_ID bmse010163
_Sample.ID 2
_Sample.Type solution
loop_
_Sample_component.ID
_Sample_component.Mol_common_name
_Sample_component.Isotopic_labeling
_Sample_component.Entity_ID
_Sample_component.Entity_label
_Sample_component.Product_ID
_Sample_component.Type
_Sample_component.Concentration_val
_Sample_component.Concentration_val_min
_Sample_component.Concentration_val_max
_Sample_component.Concentration_val_units
_Sample_component.Concentration_val_err
_Sample_component.Vendor
_Sample_component.Vendor_product_name
_Sample_component.Vendor_product_code
_Sample_component.Entry_ID
_Sample_component.Sample_ID
1 lignin_cw_compound_246 'natural abundance' 1 $lignin_cw_compound_246 ? Solute Saturated ? ? 1 ? 'Sally Ralph' lignin_cw_compound_246 n/a bmse010163 2
2 acetone '100% deuterated' 1 ? ? Solvent 100 ? ? % ? ? ? ? bmse010163 2
stop_
save_
#####################################
# Sample contents and methodology #
#####################################
########################
# Sample description #
########################
save_sample_3
_Sample.Sf_category sample
_Sample.Sf_framecode sample_3
_Sample.Entry_ID bmse010163
_Sample.ID 3
_Sample.Type solution
loop_
_Sample_component.ID
_Sample_component.Mol_common_name
_Sample_component.Isotopic_labeling
_Sample_component.Entity_ID
_Sample_component.Entity_label
_Sample_component.Product_ID
_Sample_component.Type
_Sample_component.Concentration_val
_Sample_component.Concentration_val_min
_Sample_component.Concentration_val_max
_Sample_component.Concentration_val_units
_Sample_component.Concentration_val_err
_Sample_component.Vendor
_Sample_component.Vendor_product_name
_Sample_component.Vendor_product_code
_Sample_component.Entry_ID
_Sample_component.Sample_ID
1 lignin_cw_compound_246 'natural abundance' 1 $lignin_cw_compound_246 ? Solute Saturated ? ? 1 ? 'Sally Ralph' lignin_cw_compound_246 n/a bmse010163 3
2 DMSO '100% deuterated' 1 ? ? Solvent 100 ? ? % ? ? ? ? bmse010163 3
stop_
save_
#######################
# Sample conditions #
#######################
save_sample_conditions_1
_Sample_condition_list.Sf_category sample_conditions
_Sample_condition_list.Sf_framecode sample_conditions_1
_Sample_condition_list.Entry_ID bmse010163
_Sample_condition_list.ID 1
loop_
_Sample_condition_variable.Type
_Sample_condition_variable.Val
_Sample_condition_variable.Val_err
_Sample_condition_variable.Val_units
_Sample_condition_variable.Entry_ID
_Sample_condition_variable.Sample_condition_list_ID
pH n/a ? pH bmse010163 1
temperature 297 ? K bmse010163 1
stop_
save_
############################
# Computer software used #
############################
save_software_1
_Software.Sf_category software
_Software.Sf_framecode software_1
_Software.Entry_ID bmse010163
_Software.ID 1
_Software.Name X-WINNMR
_Software.Version ?
_Software.Details ?
loop_
_Vendor.Name
_Vendor.Address
_Vendor.Electronic_address
_Vendor.Entry_ID
_Vendor.Software_ID
Bruker ? ? bmse010163 1
stop_
loop_
_Task.Task
_Task.Entry_ID
_Task.Software_ID
Processing bmse010163 1
stop_
save_
#########################
# Experimental detail #
#########################
##################################
# NMR Spectrometer definitions #
##################################
save_Bruker_250
_NMR_spectrometer.Sf_category NMR_spectrometer
_NMR_spectrometer.Sf_framecode Bruker_250
_NMR_spectrometer.Entry_ID bmse010163
_NMR_spectrometer.ID 1
_NMR_spectrometer.Manufacturer Bruker
_NMR_spectrometer.Model WM
_NMR_spectrometer.Field_strength 250
save_
#############################
# NMR applied experiments #
#############################
save_experiment_list
_Experiment_list.Sf_category experiment_list
_Experiment_list.Sf_framecode experiment_list
_Experiment_list.Entry_ID bmse010163
_Experiment_list.ID 1
_Experiment_list.Details ?
loop_
_Experiment.ID
_Experiment.Name
_Experiment.Raw_data_flag
_Experiment.NMR_spec_expt_ID
_Experiment.NMR_spec_expt_label
_Experiment.Sample_ID
_Experiment.Sample_label
_Experiment.Sample_state
_Experiment.Sample_condition_list_ID
_Experiment.Sample_condition_list_label
_Experiment.NMR_spectrometer_ID
_Experiment.NMR_spectrometer_label
_Experiment.NMR_spectral_processing_ID
_Experiment.NMR_spectral_processing_label
_Experiment.Entry_ID
_Experiment.Experiment_list_ID
1 '1D 13C' no ? ? 1 $sample_1 isotropic 1 $sample_conditions_1 1 $Bruker_250 ? ? bmse010163 1
2 '1D 1H' no ? ? 2 $sample_2 isotropic 1 $sample_conditions_1 1 $Bruker_250 ? ? bmse010163 1
3 '1D 13C' no ? ? 2 $sample_2 isotropic 1 $sample_conditions_1 1 $Bruker_250 ? ? bmse010163 1
4 '1D 13C' no ? ? 3 $sample_3 isotropic 1 $sample_conditions_1 1 $Bruker_250 ? ? bmse010163 1
stop_
save_
####################
# NMR parameters #
####################
##############################
# Assigned chemical shifts #
##############################
################################
# Chemical shift referencing #
################################
save_chem_shift_reference_1
_Chem_shift_reference.Sf_category chem_shift_reference
_Chem_shift_reference.Sf_framecode chem_shift_reference_1
_Chem_shift_reference.Entry_ID bmse010163
_Chem_shift_reference.ID 1
_Chem_shift_reference.Details ?
loop_
_Chem_shift_ref.Atom_type
_Chem_shift_ref.Atom_isotope_number
_Chem_shift_ref.Mol_common_name
_Chem_shift_ref.Atom_group
_Chem_shift_ref.Chem_shift_units
_Chem_shift_ref.Chem_shift_val
_Chem_shift_ref.Ref_method
_Chem_shift_ref.Ref_type
_Chem_shift_ref.Indirect_shift_ratio
_Chem_shift_ref.External_ref_loc
_Chem_shift_ref.External_ref_sample_geometry
_Chem_shift_ref.External_ref_axis
_Chem_shift_ref.Entry_ID
_Chem_shift_ref.Chem_shift_reference_ID
H 1 CDCl3 'residual solvent proton' ppm 7.24 internal direct 1.000000000 ? ? ? bmse010163 1
C 13 CDCl3 'solvent carbon' ppm 77.00 internal direct ? ? ? ? bmse010163 1
stop_
save_
####################
# NMR parameters #
####################
##############################
# Assigned chemical shifts #
##############################
################################
# Chemical shift referencing #
################################
save_chem_shift_reference_2
_Chem_shift_reference.Sf_category chem_shift_reference
_Chem_shift_reference.Sf_framecode chem_shift_reference_2
_Chem_shift_reference.Entry_ID bmse010163
_Chem_shift_reference.ID 2
_Chem_shift_reference.Details ?
loop_
_Chem_shift_ref.Atom_type
_Chem_shift_ref.Atom_isotope_number
_Chem_shift_ref.Mol_common_name
_Chem_shift_ref.Atom_group
_Chem_shift_ref.Chem_shift_units
_Chem_shift_ref.Chem_shift_val
_Chem_shift_ref.Ref_method
_Chem_shift_ref.Ref_type
_Chem_shift_ref.Indirect_shift_ratio
_Chem_shift_ref.External_ref_loc
_Chem_shift_ref.External_ref_sample_geometry
_Chem_shift_ref.External_ref_axis
_Chem_shift_ref.Entry_ID
_Chem_shift_ref.Chem_shift_reference_ID
H 1 Acetone-d6 'residual solvent methyl proton' ppm 2.04 internal direct 1.000000000 ? ? ? bmse010163 2
C 13 Acetone-d6 'solvent methyl carbon' ppm 29.83 internal direct ? ? ? ? bmse010163 2
stop_
save_
####################
# NMR parameters #
####################
##############################
# Assigned chemical shifts #
##############################
################################
# Chemical shift referencing #
################################
save_chem_shift_reference_3
_Chem_shift_reference.Sf_category chem_shift_reference
_Chem_shift_reference.Sf_framecode chem_shift_reference_3
_Chem_shift_reference.Entry_ID bmse010163
_Chem_shift_reference.ID 3
_Chem_shift_reference.Details ?
loop_
_Chem_shift_ref.Atom_type
_Chem_shift_ref.Atom_isotope_number
_Chem_shift_ref.Mol_common_name
_Chem_shift_ref.Atom_group
_Chem_shift_ref.Chem_shift_units
_Chem_shift_ref.Chem_shift_val
_Chem_shift_ref.Ref_method
_Chem_shift_ref.Ref_type
_Chem_shift_ref.Indirect_shift_ratio
_Chem_shift_ref.External_ref_loc
_Chem_shift_ref.External_ref_sample_geometry
_Chem_shift_ref.External_ref_axis
_Chem_shift_ref.Entry_ID
_Chem_shift_ref.Chem_shift_reference_ID
H 1 DMSO-d6 'residual solvent methyl proton' ppm 2.49 internal direct 1.000000000 ? ? ? bmse010163 3
C 13 DMSO-d6 'solvent methyl carbon' ppm 39.50 internal direct ? ? ? ? bmse010163 3
stop_
save_
###################################
# Assigned chemical shift lists #
###################################
###################################################################
# Chemical Shift Ambiguity Index Value Definitions #
# #
# The values other than 1 are used for those atoms with different #
# chemical shifts that cannot be assigned to stereospecific atoms #
# or to specific residues or chains. #
# #
# Index Value Definition #
# #
# 1 Unique (including isolated methyl protons, #
# geminal atoms, and geminal methyl #
# groups with identical chemical shifts) #
# (e.g. ILE HD11, HD12, HD13 protons) #
# 2 Ambiguity of geminal atoms or geminal methyl #
# proton groups (e.g. ASP HB2 and HB3 #
# protons, LEU CD1 and CD2 carbons, or #
# LEU HD11, HD12, HD13 and HD21, HD22, #
# HD23 methyl protons) #
# 3 Aromatic atoms on opposite sides of #
# symmetrical rings (e.g. TYR HE1 and HE2 #
# protons) #
# 4 Intraresidue ambiguities (e.g. LYS HG and #
# HD protons or TRP HZ2 and HZ3 protons) #
# 5 Interresidue ambiguities (LYS 12 vs. LYS 27) #
# 6 Intermolecular ambiguities (e.g. ASP 31 CA #
# in monomer 1 and ASP 31 CA in monomer 2 #
# of an asymmetrical homodimer, duplex #
# DNA assignments, or other assignments #
# that may apply to atoms in one or more #
# molecule in the molecular assembly) #
# 9 Ambiguous, specific ambiguity not defined #
# #
###################################################################
save_assigned_chemical_shifts_1
_Assigned_chem_shift_list.Sf_category assigned_chemical_shifts
_Assigned_chem_shift_list.Sf_framecode assigned_chemical_shifts_1
_Assigned_chem_shift_list.Entry_ID bmse010163
_Assigned_chem_shift_list.ID 1
_Assigned_chem_shift_list.Sample_condition_list_ID 1
_Assigned_chem_shift_list.Sample_condition_list_label $sample_conditions_1
_Assigned_chem_shift_list.Chem_shift_reference_ID 1
_Assigned_chem_shift_list.Chem_shift_reference_label $chem_shift_reference_1
_Assigned_chem_shift_list.Error_derivation_method ?
_Assigned_chem_shift_list.Details ?
loop_
_Chem_shift_experiment.Experiment_ID
_Chem_shift_experiment.Experiment_name
_Chem_shift_experiment.Sample_ID
_Chem_shift_experiment.Sample_label
_Chem_shift_experiment.Entry_ID
_Chem_shift_experiment.Assigned_chem_shift_list_ID
1 '1D 13C' 1 $sample_1 bmse010163 1
stop_
loop_
_Chem_shift_software.Software_ID
_Chem_shift_software.Software_label
_Chem_shift_software.Method_ID
_Chem_shift_software.Method_label
_Chem_shift_software.Entry_ID
_Chem_shift_software.Assigned_chem_shift_list_ID
1 $software_1 ? ? bmse010163 1
stop_
loop_
_Atom_chem_shift.ID
_Atom_chem_shift.Assembly_atom_ID
_Atom_chem_shift.Entity_assembly_ID
_Atom_chem_shift.Entity_ID
_Atom_chem_shift.Comp_index_ID
_Atom_chem_shift.Seq_ID
_Atom_chem_shift.Comp_ID
_Atom_chem_shift.Atom_ID
_Atom_chem_shift.Atom_type
_Atom_chem_shift.Atom_isotope_number
_Atom_chem_shift.Val
_Atom_chem_shift.Val_err
_Atom_chem_shift.Assign_fig_of_merit
_Atom_chem_shift.Ambiguity_code
_Atom_chem_shift.Occupancy
_Atom_chem_shift.Resonance_ID
_Atom_chem_shift.Auth_entity_assembly_ID
_Atom_chem_shift.Auth_seq_ID
_Atom_chem_shift.Auth_comp_ID
_Atom_chem_shift.Auth_atom_ID
_Atom_chem_shift.Details
_Atom_chem_shift.Entry_ID
_Atom_chem_shift.Assigned_chem_shift_list_ID
1 ? 1 1 1 1 1 C3 C 13 20.43 ? ? 1 ? ? ? ? ? A4AcMe ? bmse010163 1
2 ? 1 1 1 1 1 C2 C 13 20.75 ? ? 1 ? ? ? ? ? GAcMe ? bmse010163 1
3 ? 1 1 1 1 1 C1 C 13 21.82 ? ? 1 ? ? ? ? ? BA ? bmse010163 1
4 ? 1 1 1 1 1 C4 C 13 55.86 ? ? 1 ? ? ? ? ? BOMe ? bmse010163 1
5 ? 1 1 1 1 1 C5 C 13 55.86 ? ? 1 ? ? ? ? ? BOMe ? bmse010163 1
6 ? 1 1 1 1 1 C6 C 13 56.29 ? ? 1 ? ? ? ? ? AOMe ? bmse010163 1
7 ? 1 1 1 1 1 C7 C 13 56.29 ? ? 1 ? ? ? ? ? AOMe ? bmse010163 1
8 ? 1 1 1 1 1 C12 C 13 64.15 ? ? 1 ? ? ? ? ? G ? bmse010163 1
9 ? 1 1 1 1 1 C21 C 13 81.65 ? ? 1 ? ? ? ? ? B ? bmse010163 1
10 ? 1 1 1 1 1 C8 C 13 105.93 ? ? 1 ? ? ? ? ? B2 ? bmse010163 1
11 ? 1 1 1 1 1 C9 C 13 105.93 ? ? 1 ? ? ? ? ? B6 ? bmse010163 1
12 ? 1 1 1 1 1 C10 C 13 106.25 ? ? 1 ? ? ? ? ? A2 ? bmse010163 1
13 ? 1 1 1 1 1 C11 C 13 106.25 ? ? 1 ? ? ? ? ? A6 ? bmse010163 1
14 ? 1 1 1 1 1 C23 C 13 133.03 ? ? 1 ? ? ? ? ? A4 ? bmse010163 1
15 ? 1 1 1 1 1 C24 C 13 133.50 ? ? 1 ? ? ? ? ? B4 ? bmse010163 1
16 ? 1 1 1 1 1 C16 C 13 133.57 ? ? 1 ? ? ? ? ? A1 ? bmse010163 1
17 ? 1 1 1 1 1 C13 C 13 134.31 ? ? 1 ? ? ? ? ? B1 ? bmse010163 1
18 ? 1 1 1 1 1 C19 C 13 152.09 ? ? 1 ? ? ? ? ? A3 ? bmse010163 1
19 ? 1 1 1 1 1 C20 C 13 152.09 ? ? 1 ? ? ? ? ? A5 ? bmse010163 1
20 ? 1 1 1 1 1 C17 C 13 152.49 ? ? 1 ? ? ? ? ? B3 ? bmse010163 1
21 ? 1 1 1 1 1 C18 C 13 152.49 ? ? 1 ? ? ? ? ? B5 ? bmse010163 1
22 ? 1 1 1 1 1 C15 C 13 168.14 ? ? 1 ? ? ? ? ? A4AcC=O ? bmse010163 1
23 ? 1 1 1 1 1 C14 C 13 170.75 ? ? 1 ? ? ? ? ? GAcC=O ? bmse010163 1
24 ? 1 1 1 1 1 C22 C 13 194.84 ? ? 1 ? ? ? ? ? A ? bmse010163 1
stop_
save_
###################################
# Assigned chemical shift lists #
###################################
###################################################################
# Chemical Shift Ambiguity Index Value Definitions #
# #
# The values other than 1 are used for those atoms with different #
# chemical shifts that cannot be assigned to stereospecific atoms #
# or to specific residues or chains. #
# #
# Index Value Definition #
# #
# 1 Unique (including isolated methyl protons, #
# geminal atoms, and geminal methyl #
# groups with identical chemical shifts) #
# (e.g. ILE HD11, HD12, HD13 protons) #
# 2 Ambiguity of geminal atoms or geminal methyl #
# proton groups (e.g. ASP HB2 and HB3 #
# protons, LEU CD1 and CD2 carbons, or #
# LEU HD11, HD12, HD13 and HD21, HD22, #
# HD23 methyl protons) #
# 3 Aromatic atoms on opposite sides of #
# symmetrical rings (e.g. TYR HE1 and HE2 #
# protons) #
# 4 Intraresidue ambiguities (e.g. LYS HG and #
# HD protons or TRP HZ2 and HZ3 protons) #
# 5 Interresidue ambiguities (LYS 12 vs. LYS 27) #
# 6 Intermolecular ambiguities (e.g. ASP 31 CA #
# in monomer 1 and ASP 31 CA in monomer 2 #
# of an asymmetrical homodimer, duplex #
# DNA assignments, or other assignments #
# that may apply to atoms in one or more #
# molecule in the molecular assembly) #
# 9 Ambiguous, specific ambiguity not defined #
# #
###################################################################
save_assigned_chemical_shifts_2
_Assigned_chem_shift_list.Sf_category assigned_chemical_shifts
_Assigned_chem_shift_list.Sf_framecode assigned_chemical_shifts_2
_Assigned_chem_shift_list.Entry_ID bmse010163
_Assigned_chem_shift_list.ID 2
_Assigned_chem_shift_list.Sample_condition_list_ID 1
_Assigned_chem_shift_list.Sample_condition_list_label $sample_conditions_1
_Assigned_chem_shift_list.Chem_shift_reference_ID 2
_Assigned_chem_shift_list.Chem_shift_reference_label $chem_shift_reference_2
_Assigned_chem_shift_list.Error_derivation_method ?
_Assigned_chem_shift_list.Details ?
loop_
_Chem_shift_experiment.Experiment_ID
_Chem_shift_experiment.Experiment_name
_Chem_shift_experiment.Sample_ID
_Chem_shift_experiment.Sample_label
_Chem_shift_experiment.Entry_ID
_Chem_shift_experiment.Assigned_chem_shift_list_ID
2 '1D 1H' 2 $sample_2 bmse010163 2
3 '1D 13C' 2 $sample_2 bmse010163 2
stop_
loop_
_Chem_shift_software.Software_ID
_Chem_shift_software.Software_label
_Chem_shift_software.Method_ID
_Chem_shift_software.Method_label
_Chem_shift_software.Entry_ID
_Chem_shift_software.Assigned_chem_shift_list_ID
1 $software_1 ? ? bmse010163 2
stop_
loop_
_Atom_chem_shift.ID
_Atom_chem_shift.Assembly_atom_ID
_Atom_chem_shift.Entity_assembly_ID
_Atom_chem_shift.Entity_ID
_Atom_chem_shift.Comp_index_ID
_Atom_chem_shift.Seq_ID
_Atom_chem_shift.Comp_ID
_Atom_chem_shift.Atom_ID
_Atom_chem_shift.Atom_type
_Atom_chem_shift.Atom_isotope_number
_Atom_chem_shift.Val
_Atom_chem_shift.Val_err
_Atom_chem_shift.Assign_fig_of_merit
_Atom_chem_shift.Ambiguity_code
_Atom_chem_shift.Occupancy
_Atom_chem_shift.Resonance_ID
_Atom_chem_shift.Auth_entity_assembly_ID
_Atom_chem_shift.Auth_seq_ID
_Atom_chem_shift.Auth_comp_ID
_Atom_chem_shift.Auth_atom_ID
_Atom_chem_shift.Details
_Atom_chem_shift.Entry_ID
_Atom_chem_shift.Assigned_chem_shift_list_ID
1 ? 1 1 1 1 1 C3 C 13 20.22 ? ? 1 ? ? ? ? ? A4AcMe ? bmse010163 2
2 ? 1 1 1 1 1 C2 C 13 20.60 ? ? 1 ? ? ? ? ? GAcMe ? bmse010163 2
3 ? 1 1 1 1 1 C1 C 13 21.73 ? ? 1 ? ? ? ? ? BA ? bmse010163 2
4 ? 1 1 1 1 1 C4 C 13 56.19 ? ? 1 ? ? ? ? ? BOMe ? bmse010163 2
5 ? 1 1 1 1 1 C5 C 13 56.19 ? ? 1 ? ? ? ? ? BOMe ? bmse010163 2
6 ? 1 1 1 1 1 C6 C 13 56.60 ? ? 1 ? ? ? ? ? AOMe ? bmse010163 2
7 ? 1 1 1 1 1 C7 C 13 56.60 ? ? 1 ? ? ? ? ? AOMe ? bmse010163 2
8 ? 1 1 1 1 1 C12 C 13 64.34 ? ? 1 ? ? ? ? ? G ? bmse010163 2
9 ? 1 1 1 1 1 C21 C 13 81.24 ? ? 1 ? ? ? ? ? B ? bmse010163 2
10 ? 1 1 1 1 1 C8 C 13 106.75 ? ? 1 ? ? ? ? ? B2 ? bmse010163 2
11 ? 1 1 1 1 1 C9 C 13 106.75 ? ? 1 ? ? ? ? ? B6 ? bmse010163 2
12 ? 1 1 1 1 1 C10 C 13 106.80 ? ? 1 ? ? ? ? ? A2 ? bmse010163 2
13 ? 1 1 1 1 1 C11 C 13 106.80 ? ? 1 ? ? ? ? ? A6 ? bmse010163 2
14 ? 1 1 1 1 1 C23 C 13 133.82 ? ? 1 ? ? ? ? ? A4 ? bmse010163 2
15 ? 1 1 1 1 1 C24 C 13 134.25 ? ? 1 ? ? ? ? ? B4 ? bmse010163 2
16 ? 1 1 1 1 1 C16 C 13 134.72 ? ? 1 ? ? ? ? ? A1 ? bmse010163 2
17 ? 1 1 1 1 1 C13 C 13 134.88 ? ? 1 ? ? ? ? ? B1 ? bmse010163 2
18 ? 1 1 1 1 1 C19 C 13 153.11 ? ? 1 ? ? ? ? ? A3 ? bmse010163 2
19 ? 1 1 1 1 1 C20 C 13 153.11 ? ? 1 ? ? ? ? ? A5 ? bmse010163 2
20 ? 1 1 1 1 1 C17 C 13 153.51 ? ? 1 ? ? ? ? ? B3 ? bmse010163 2
21 ? 1 1 1 1 1 C18 C 13 153.51 ? ? 1 ? ? ? ? ? B5 ? bmse010163 2
22 ? 1 1 1 1 1 C15 C 13 168.20 ? ? 1 ? ? ? ? ? A4AcC=O ? bmse010163 2
23 ? 1 1 1 1 1 C14 C 13 170.73 ? ? 1 ? ? ? ? ? GAcC=O ? bmse010163 2
24 ? 1 1 1 1 1 C22 C 13 195.23 ? ? 1 ? ? ? ? ? A ? bmse010163 2
25 ? 1 1 1 1 1 H43 H 1 1.90 ? ? 1 ? ? ? ? ? A4AcMe ? bmse010163 2
26 ? 1 1 1 1 1 H42 H 1 1.90 ? ? 1 ? ? ? ? ? A4AcMe ? bmse010163 2
27 ? 1 1 1 1 1 H41 H 1 1.90 ? ? 1 ? ? ? ? ? A4AcMe ? bmse010163 2
28 ? 1 1 1 1 1 H36 H 1 2.08 ? ? 1 ? ? ? ? ? BA ? bmse010163 2
29 ? 1 1 1 1 1 H35 H 1 2.08 ? ? 1 ? ? ? ? ? BA ? bmse010163 2
30 ? 1 1 1 1 1 H37 H 1 2.08 ? ? 1 ? ? ? ? ? BA ? bmse010163 2
31 ? 1 1 1 1 1 H38 H 1 2.26 ? ? 1 ? ? ? ? ? GAcMe ? bmse010163 2
32 ? 1 1 1 1 1 H39 H 1 2.26 ? ? 1 ? ? ? ? ? GAcMe ? bmse010163 2
33 ? 1 1 1 1 1 H40 H 1 2.26 ? ? 1 ? ? ? ? ? GAcMe ? bmse010163 2
34 ? 1 1 1 1 1 H46 H 1 3.70 ? ? 1 ? ? ? ? ? BOMe ? bmse010163 2
35 ? 1 1 1 1 1 H45 H 1 3.70 ? ? 1 ? ? ? ? ? BOMe ? bmse010163 2
36 ? 1 1 1 1 1 H48 H 1 3.70 ? ? 1 ? ? ? ? ? BOMe ? bmse010163 2
37 ? 1 1 1 1 1 H47 H 1 3.85 ? ? 1 ? ? ? ? ? AOMe ? bmse010163 2
38 ? 1 1 1 1 1 H49 H 1 3.85 ? ? 1 ? ? ? ? ? AOMe ? bmse010163 2
39 ? 1 1 1 1 1 H50 H 1 3.85 ? ? 1 ? ? ? ? ? AOMe ? bmse010163 2
40 ? 1 1 1 1 1 H60 H 1 4.49 ? ? 1 ? ? ? ? ? G ? bmse010163 2
41 ? 1 1 1 1 1 H61 H 1 4.49 ? ? 1 ? ? ? ? ? G ? bmse010163 2
42 ? 1 1 1 1 1 H62 H 1 5.50 ? ? 1 ? ? ? ? ? B ? bmse010163 2
43 ? 1 1 1 1 1 H56 H 1 6.47 ? ? 1 ? ? ? ? ? B2 ? bmse010163 2
44 ? 1 1 1 1 1 H57 H 1 6.47 ? ? 1 ? ? ? ? ? B6 ? bmse010163 2
45 ? 1 1 1 1 1 H58 H 1 7.49 ? ? 1 ? ? ? ? ? A2 ? bmse010163 2
46 ? 1 1 1 1 1 H59 H 1 7.49 ? ? 1 ? ? ? ? ? A6 ? bmse010163 2
stop_
save_
###################################
# Assigned chemical shift lists #
###################################
###################################################################
# Chemical Shift Ambiguity Index Value Definitions #
# #
# The values other than 1 are used for those atoms with different #
# chemical shifts that cannot be assigned to stereospecific atoms #
# or to specific residues or chains. #
# #
# Index Value Definition #
# #
# 1 Unique (including isolated methyl protons, #
# geminal atoms, and geminal methyl #
# groups with identical chemical shifts) #
# (e.g. ILE HD11, HD12, HD13 protons) #
# 2 Ambiguity of geminal atoms or geminal methyl #
# proton groups (e.g. ASP HB2 and HB3 #
# protons, LEU CD1 and CD2 carbons, or #
# LEU HD11, HD12, HD13 and HD21, HD22, #
# HD23 methyl protons) #
# 3 Aromatic atoms on opposite sides of #
# symmetrical rings (e.g. TYR HE1 and HE2 #
# protons) #
# 4 Intraresidue ambiguities (e.g. LYS HG and #
# HD protons or TRP HZ2 and HZ3 protons) #
# 5 Interresidue ambiguities (LYS 12 vs. LYS 27) #
# 6 Intermolecular ambiguities (e.g. ASP 31 CA #
# in monomer 1 and ASP 31 CA in monomer 2 #
# of an asymmetrical homodimer, duplex #
# DNA assignments, or other assignments #
# that may apply to atoms in one or more #
# molecule in the molecular assembly) #
# 9 Ambiguous, specific ambiguity not defined #
# #
###################################################################
save_assigned_chemical_shifts_3
_Assigned_chem_shift_list.Sf_category assigned_chemical_shifts
_Assigned_chem_shift_list.Sf_framecode assigned_chemical_shifts_3
_Assigned_chem_shift_list.Entry_ID bmse010163
_Assigned_chem_shift_list.ID 3
_Assigned_chem_shift_list.Sample_condition_list_ID 1
_Assigned_chem_shift_list.Sample_condition_list_label $sample_conditions_1
_Assigned_chem_shift_list.Chem_shift_reference_ID 3
_Assigned_chem_shift_list.Chem_shift_reference_label $chem_shift_reference_3
_Assigned_chem_shift_list.Error_derivation_method ?
_Assigned_chem_shift_list.Details ?
loop_
_Chem_shift_experiment.Experiment_ID
_Chem_shift_experiment.Experiment_name
_Chem_shift_experiment.Sample_ID
_Chem_shift_experiment.Sample_label
_Chem_shift_experiment.Entry_ID
_Chem_shift_experiment.Assigned_chem_shift_list_ID
4 '1D 13C' 3 $sample_3 bmse010163 3
stop_
loop_
_Chem_shift_software.Software_ID
_Chem_shift_software.Software_label
_Chem_shift_software.Method_ID
_Chem_shift_software.Method_label
_Chem_shift_software.Entry_ID
_Chem_shift_software.Assigned_chem_shift_list_ID
1 $software_1 ? ? bmse010163 3
stop_
loop_
_Atom_chem_shift.ID
_Atom_chem_shift.Assembly_atom_ID
_Atom_chem_shift.Entity_assembly_ID
_Atom_chem_shift.Entity_ID
_Atom_chem_shift.Comp_index_ID
_Atom_chem_shift.Seq_ID
_Atom_chem_shift.Comp_ID
_Atom_chem_shift.Atom_ID
_Atom_chem_shift.Atom_type
_Atom_chem_shift.Atom_isotope_number
_Atom_chem_shift.Val
_Atom_chem_shift.Val_err
_Atom_chem_shift.Assign_fig_of_merit
_Atom_chem_shift.Ambiguity_code
_Atom_chem_shift.Occupancy
_Atom_chem_shift.Resonance_ID
_Atom_chem_shift.Auth_entity_assembly_ID
_Atom_chem_shift.Auth_seq_ID
_Atom_chem_shift.Auth_comp_ID
_Atom_chem_shift.Auth_atom_ID
_Atom_chem_shift.Details
_Atom_chem_shift.Entry_ID
_Atom_chem_shift.Assigned_chem_shift_list_ID
1 ? 1 1 1 1 1 C3 C 13 20.08 ? ? 1 ? ? ? ? ? A4AcMe ? bmse010163 3
2 ? 1 1 1 1 1 C2 C 13 20.42 ? ? 1 ? ? ? ? ? GAcMe ? bmse010163 3
3 ? 1 1 1 1 1 C1 C 13 21.32 ? ? 1 ? ? ? ? ? BA ? bmse010163 3
4 ? 1 1 1 1 1 C4 C 13 55.65 ? ? 1 ? ? ? ? ? BOMe ? bmse010163 3
5 ? 1 1 1 1 1 C5 C 13 55.65 ? ? 1 ? ? ? ? ? BOMe ? bmse010163 3
6 ? 1 1 1 1 1 C6 C 13 56.12 ? ? 1 ? ? ? ? ? AOMe ? bmse010163 3
7 ? 1 1 1 1 1 C7 C 13 56.12 ? ? 1 ? ? ? ? ? AOMe ? bmse010163 3
8 ? 1 1 1 1 1 C12 C 13 63.26 ? ? 1 ? ? ? ? ? G ? bmse010163 3
9 ? 1 1 1 1 1 C21 C 13 79.70 ? ? 1 ? ? ? ? ? B ? bmse010163 3
10 ? 1 1 1 1 1 C8 C 13 105.93 ? ? 1 ? ? ? ? ? B2 ? bmse010163 3
11 ? 1 1 1 1 1 C9 C 13 105.93 ? ? 1 ? ? ? ? ? B6 ? bmse010163 3
12 ? 1 1 1 1 1 C10 C 13 105.58 ? ? 1 ? ? ? ? ? A2 ? bmse010163 3
13 ? 1 1 1 1 1 C11 C 13 105.58 ? ? 1 ? ? ? ? ? A6 ? bmse010163 3
14 ? 1 1 1 1 1 C23 C 13 132.20 ? ? 1 ? ? ? ? ? A4 ? bmse010163 3
15 ? 1 1 1 1 1 C24 C 13 132.74 ? ? 1 ? ? ? ? ? B4 ? bmse010163 3
16 ? 1 1 1 1 1 C16 C 13 133.61 ? ? 1 ? ? ? ? ? A1 ? bmse010163 3
17 ? 1 1 1 1 1 C13 C 13 133.33 ? ? 1 ? ? ? ? ? B1 ? bmse010163 3
18 ? 1 1 1 1 1 C19 C 13 151.75 ? ? 1 ? ? ? ? ? A3 ? bmse010163 3
19 ? 1 1 1 1 1 C20 C 13 151.75 ? ? 1 ? ? ? ? ? A5 ? bmse010163 3
20 ? 1 1 1 1 1 C17 C 13 152.05 ? ? 1 ? ? ? ? ? B3 ? bmse010163 3
21 ? 1 1 1 1 1 C18 C 13 152.05 ? ? 1 ? ? ? ? ? B5 ? bmse010163 3
22 ? 1 1 1 1 1 C15 C 13 167.79 ? ? 1 ? ? ? ? ? A4AcC=O ? bmse010163 3
23 ? 1 1 1 1 1 C14 C 13 170.03 ? ? 1 ? ? ? ? ? GAcC=O ? bmse010163 3
24 ? 1 1 1 1 1 C22 C 13 194.40 ? ? 1 ? ? ? ? ? A ? bmse010163 3
stop_
save_